4-Thiazolidinone,5-(2-naphthalenylmethylene)-3-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-2-thioxo- structure
|
Common Name | 4-Thiazolidinone,5-(2-naphthalenylmethylene)-3-(2,3,4,6-tetra-O-acetyl-b-D-glucopyranosyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 65562-41-6 | Molecular Weight | 601.64500 | |
| Density | 1.45g/cm3 | Boiling Point | 688.2ºC at 760mmHg | |
| Molecular Formula | C28H27NO10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 370ºC | |
| Name | [3,4,5-triacetyloxy-6-[(5Z)-5-(naphthalen-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 688.2ºC at 760mmHg |
| Molecular Formula | C28H27NO10S2 |
| Molecular Weight | 601.64500 |
| Flash Point | 370ºC |
| Exact Mass | 601.10800 |
| PSA | 192.13000 |
| LogP | 3.06200 |
| Index of Refraction | 1.651 |
| InChIKey | HOPIENTYEUZPIV-UUYOSTAYSA-N |
| SMILES | CC(=O)OCC1OC(N2C(=O)C(=Cc3ccc4ccccc4c3)SC2=S)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~%
4-Thiazolidinon... CAS#:65562-41-6 |
| Literature: Foye; Tovivich Journal of Pharmaceutical Sciences, 1977 , vol. 66, # 11 p. 1607 - 1611 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |