[3,4,5-triacetyloxy-6-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-thiazolidin-3-yl]oxan-2-yl]methyl acetate structure
|
Common Name | [3,4,5-triacetyloxy-6-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-thiazolidin-3-yl]oxan-2-yl]methyl acetate | ||
|---|---|---|---|---|
| CAS Number | 65562-27-8 | Molecular Weight | 586.03100 | |
| Density | 1.49g/cm3 | Boiling Point | 646.9ºC at 760 mmHg | |
| Molecular Formula | C24H24ClNO10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345ºC | |
| Name | [3,4,5-triacetyloxy-6-[(5Z)-5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]oxan-2-yl]methyl acetate |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 646.9ºC at 760 mmHg |
| Molecular Formula | C24H24ClNO10S2 |
| Molecular Weight | 586.03100 |
| Flash Point | 345ºC |
| Exact Mass | 585.05300 |
| PSA | 192.13000 |
| LogP | 2.56220 |
| Index of Refraction | 1.624 |
| InChIKey | OPMJIWCAYZDKKJ-NVMNQCDNSA-N |
| SMILES | CC(=O)OCC1OC(N2C(=O)C(=Cc3ccc(Cl)cc3)SC2=S)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
|
~%
[3,4,5-triacety... CAS#:65562-27-8 |
| Literature: Foye; Tovivich Journal of Pharmaceutical Sciences, 1977 , vol. 66, # 11 p. 1607 - 1611 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |