1-Imino-1H-benzo[f]isoindol-3-amine structure
|
Common Name | 1-Imino-1H-benzo[f]isoindol-3-amine | ||
|---|---|---|---|---|
| CAS Number | 65558-69-2 | Molecular Weight | 195.220 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 354.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H9N3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 168.4±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,3-Diiminobenz[f]isoindoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.8±25.0 °C at 760 mmHg |
| Molecular Formula | C12H9N3 |
| Molecular Weight | 195.220 |
| Flash Point | 168.4±23.2 °C |
| Exact Mass | 195.079651 |
| PSA | 59.73000 |
| LogP | 1.55 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.762 |
| InChIKey | JAWNWEKHDFBPSG-UHFFFAOYSA-N |
| SMILES | N=C1N=C(N)c2cc3ccccc3cc21 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~84%
1-Imino-1H-benz... CAS#:65558-69-2 |
| Literature: Wheeler; Nagasubramanian; Bard; Schechtman; Dininny; Kenney Journal of the American Chemical Society, 1984 , vol. 106, # 24 p. 7404 - 7410 |
|
~%
1-Imino-1H-benz... CAS#:65558-69-2 |
| Literature: Journal of the American Chemical Society, , vol. 106, # 24 p. 7404 - 7410 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Benz[f]isoindol-3-amine, 1-imino- |
| 3-iminobenzo[f]isoindol-1-amine |
| 1-Imino-1H-benzo[f]isoindol-3-amine |
| MFCD00059067 |