p-[3-(p-Methoxybenzyl)-3-methyl-1-triazeno]benzoic acid
Modify Date: 2025-10-11 12:07:09
![p-[3-(p-Methoxybenzyl)-3-methyl-1-triazeno]benzoic acid Structure](https://image.chemsrc.com/caspic/012/65542-18-9.png)
p-[3-(p-Methoxybenzyl)-3-methyl-1-triazeno]benzoic acid structure
|
Common Name | p-[3-(p-Methoxybenzyl)-3-methyl-1-triazeno]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 65542-18-9 | Molecular Weight | 299.32400 | |
| Density | 1.18g/cm3 | Boiling Point | 479.3ºC at 760 mmHg | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7ºC | |
| Name | 4-[[(4-methoxyphenyl)methyl-methylamino]diazenyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 479.3ºC at 760 mmHg |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.32400 |
| Flash Point | 243.7ºC |
| Exact Mass | 299.12700 |
| PSA | 74.49000 |
| LogP | 3.52410 |
| Index of Refraction | 1.578 |
| InChIKey | DSKLAYUHVDHXSH-UHFFFAOYSA-N |
| SMILES | COc1ccc(CN(C)N=Nc2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-(3-(p-Methoxybenzyl)-3-methyl-1-triazeno)benzoic acid |
| BENZOIC ACID,p-(3-(p-METHOXYBENZYL)-3-METHYL-1-TRIAZENO) |
| 4-[(1E)-3-(4-methoxybenzyl)-3-methyltriaz-1-en-1-yl]benzoic acid |