Aceticacid, 2-chloro-2-[2-(2-ethenylphenyl)hydrazinylidene]-,ethyl ester
Modify Date: 2025-08-25 14:42:54
![Aceticacid, 2-chloro-2-[2-(2-ethenylphenyl)hydrazinylidene]-,ethyl ester Structure](https://image.chemsrc.com/caspic/039/65480-24-2.png)
Aceticacid, 2-chloro-2-[2-(2-ethenylphenyl)hydrazinylidene]-,ethyl ester structure
|
Common Name | Aceticacid, 2-chloro-2-[2-(2-ethenylphenyl)hydrazinylidene]-,ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 65480-24-2 | Molecular Weight | 252.69700 | |
| Density | 1.15g/cm3 | Boiling Point | 344.8ºC at 760mmHg | |
| Molecular Formula | C12H13ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | ethyl (2Z)-2-chloro-2-[(2-ethenylphenyl)hydrazinylidene]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 344.8ºC at 760mmHg |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.69700 |
| Flash Point | 162.3ºC |
| Exact Mass | 252.06700 |
| PSA | 50.69000 |
| LogP | 2.92990 |
| Index of Refraction | 1.534 |
| InChIKey | YZJBHJWMLXVKOT-RVDMUPIBSA-N |
| SMILES | C=Cc1ccccc1NN=C(Cl)C(=O)OCC |
|
~%
Aceticacid, 2-c... CAS#:65480-24-2 |
| Literature: Padwa, Albert; Nahm, Steven Journal of Organic Chemistry, 1981 , vol. 46, # 7 p. 1402 - 1409 |
|
~%
Aceticacid, 2-c... CAS#:65480-24-2 |
| Literature: Padwa, Albert; Nahm, Steven Journal of Organic Chemistry, 1981 , vol. 46, # 7 p. 1402 - 1409 |
![ethyl 2-chloro-2-[(o-vinylphenyl)azo]acetoacetate structure](https://image.chemsrc.com/caspic/407/76466-73-4.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ethyl chloroglyoxylate (o-vinylphenyl)hydrazone |