2-carboxyphenyl-1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetate
Modify Date: 2025-09-20 20:07:09
2-carboxyphenyl-1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetate structure
|
Common Name | 2-carboxyphenyl-1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetate | ||
|---|---|---|---|---|
| CAS Number | 65474-39-7 | Molecular Weight | 477.89300 | |
| Density | 1.33g/cm3 | Boiling Point | 637.6ºC at 760 mmHg | |
| Molecular Formula | C26H20ClNO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 339.4ºC | |
| Name | 2-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]oxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 637.6ºC at 760 mmHg |
| Molecular Formula | C26H20ClNO6 |
| Molecular Weight | 477.89300 |
| Flash Point | 339.4ºC |
| Exact Mass | 477.09800 |
| PSA | 94.83000 |
| LogP | 5.14650 |
| Index of Refraction | 1.626 |
| InChIKey | ZMVHVVYABPAONG-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)c(CC(=O)Oc1ccccc1C(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Indole-3-acetic acid,1-(p-chlorobenzoyl)-5-methoxy-2-methyl-,ester with salicylic acid |
| (2-Carboxyphenyl) 1-(4-chlorobenzoyl)-5-methoxy-2-methylindole-3-acetate |
| 1-(p-Chlorobenzoyl)-5-methoxy-2-methylindole-3-acetic acid ester with salicylic acid |
| TB 219 |
| Indomethacin salicylate |
| 1H-Indole-3-acetic acid,1-(4-chlorobenzoyl)-5-methoxy-2-methyl-,2-carboxyphenyl ester |