[(Z)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] bis[(E)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] borate structure
|
Common Name | [(Z)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] bis[(E)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] borate | ||
|---|---|---|---|---|
| CAS Number | 65416-32-2 | Molecular Weight | 620.71100 | |
| Density | 0.994g/cm3 | Boiling Point | 662.4ºC at 760 mmHg | |
| Molecular Formula | C42H57BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.8ºC | |
| Name | [(Z)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] bis[(E)-3-(4-tert-butylphenyl)-2-methylprop-2-enyl] borate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 662.4ºC at 760 mmHg |
| Molecular Formula | C42H57BO3 |
| Molecular Weight | 620.71100 |
| Flash Point | 261.8ºC |
| Exact Mass | 620.44000 |
| PSA | 27.69000 |
| LogP | 11.22410 |
| Index of Refraction | 1.552 |
| InChIKey | YJZSBTJXLOUXMG-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccc(C(C)(C)C)cc1)COB(OCC(C)=Cc1ccc(C(C)(C)C)cc1)OCC(C)=Cc1ccc(C(C)(C)C)cc1 |
| Tris(3-(p-tert-butylphenyl)-2-methylallyl) alcohol,triester with boric acid |
| 2-Propen-1-ol,3-(4-(1,1-dimethylethyl)phenyl)-2-methyl-,triester with boric acid (H3BO3) |
| 2-Propen-1-ol,3-(4-(1,1-dimethylethyl)phenyl)-2-methyl-,1,1',1''-triester with boric acid (H3BO3) |
| EINECS 265-768-3 |