amber formate structure
|
Common Name | amber formate | ||
|---|---|---|---|---|
| CAS Number | 65405-72-3 | Molecular Weight | 236.35000 | |
| Density | 0.99g/cm3 | Boiling Point | 288.3ºC at 760 mmHg | |
| Molecular Formula | C15H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4ºC | |
| Name | sodium,1,2,3,4-tetramethyl-6,10-dioxo-7,9-diazaspiro[4.5]dec-8-en-8-olate |
|---|
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 288.3ºC at 760 mmHg |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35000 |
| Flash Point | 116.4ºC |
| Exact Mass | 236.17800 |
| PSA | 26.30000 |
| LogP | 4.34650 |
| Index of Refraction | 1.495 |
| InChIKey | DAWDTDPJINNEJM-UHFFFAOYSA-N |
| SMILES | CC1=CCCC2(C)C(OC=O)C(C)CCC12C |
| HS Code | 2915120000 |
|---|
| HS Code | 2915120000 |
|---|---|
| Summary | 2915120000 salts of formic acid。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |