1,4-Benzenediol,2,3,5-trifluoro- structure
|
Common Name | 1,4-Benzenediol,2,3,5-trifluoro- | ||
|---|---|---|---|---|
| CAS Number | 654-37-5 | Molecular Weight | 164.08200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H3F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5-trifluorobenzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H3F3O2 |
|---|---|
| Molecular Weight | 164.08200 |
| Exact Mass | 164.00900 |
| PSA | 40.46000 |
| LogP | 1.51510 |
| HS Code | 2908199090 |
|---|
|
~%
1,4-Benzenediol... CAS#:654-37-5 |
| Literature: Nield,E.; Taltow,J.C. Tetrahedron, 1960 , vol. 8, p. 38 - 41 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| QGPNCAAQXZRRMR-UHFFFAOYSA |
| 2,3,5-Trifluor-hydrochinon |
| InChI=1/C6H3F3O2/c7-2-1-3(10)4(8)5(9)6(2)11/h1,10-11H |
| 1,4-Benzenediol,2,3,5-trifluoro |
| 2,3,5-trifluoro-1,4-dihydroxybenzene |