9-(4-nitrophenyl)-1,5,7,8-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene structure
|
Common Name | 9-(4-nitrophenyl)-1,5,7,8-tetrazabicyclo[4.3.0]nona-2,4,6,8-tetraene | ||
|---|---|---|---|---|
| CAS Number | 65394-50-5 | Molecular Weight | 241.20600 | |
| Density | 1.56g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-nitrophenyl)-[1,2,4]triazolo[4,3-a]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.56g/cm3 |
|---|---|
| Molecular Formula | C11H7N5O2 |
| Molecular Weight | 241.20600 |
| Exact Mass | 241.06000 |
| PSA | 88.90000 |
| LogP | 2.22270 |
| Index of Refraction | 1.772 |
| InChIKey | ZXLIMAGSJGAAKU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc3ncccn23)cc1 |
|
~%
9-(4-nitropheny... CAS#:65394-50-5 |
| Literature: Khera, Manoj K.; Cliffe, Ian A.; Mathur, Tarun; Prakash, Om Bioorganic and Medicinal Chemistry Letters, 2011 , vol. 21, # 10 p. 2887 - 2889 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-(4-nitro-phenyl)-[1,2,4]triazolo[4,3-a]pyrimidine |
| 3-p-Nitrophenyl-s-triazolo<4,3-a>pyrimidin |