6,6'-methylenedi-2,4-xylenol structure
|
Common Name | 6,6'-methylenedi-2,4-xylenol | ||
|---|---|---|---|---|
| CAS Number | 6538-35-8 | Molecular Weight | 256.33900 | |
| Density | 1.11g/cm3 | Boiling Point | 402ºC at 760 mmHg | |
| Molecular Formula | C17H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.4ºC | |
| Name | 2-[(2-hydroxy-3,5-dimethylphenyl)methyl]-4,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 402ºC at 760 mmHg |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.33900 |
| Flash Point | 186.4ºC |
| Exact Mass | 256.14600 |
| PSA | 40.46000 |
| LogP | 3.92220 |
| Index of Refraction | 1.596 |
| InChIKey | FCIMDZFOYJBMLV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(O)c(Cc2cc(C)cc(C)c2O)c1 |
| HS Code | 2907299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,6,4',6'-Tetramethyl-2,2'-methandiyl-di-phenol |
| 2-((2-Hydroxy-3,5-dimethylphenyl)methyl)-4,6-dimethylphenol |
| 2,2'-methanediylbis(4,6-dimethylphenol) |
| 4,6,4',6'-tetramethyl-2,2'-methanediyl-di-phenol |
| 6,6'-Methylenedi-2,4-xylenol |
| 6,6'-methylene bis(2,4-dimethylphenol) |
| Bis-(2-hydroxy-3,5-dimethyl-phenyl)-methan |
| bis(3,5-dimethyl-2-hydroxyphenyl)methane |
| 2,2'-methylenebis(4,6-dimethylphenol) |
| EINECS 229-451-3 |
| 6-[(2-hydroxy-3,5-dimethylphenyl)methyl]-2,4-dimethylphenol |