butyl 2-methylprop-2-enoate,2-methylidenebutanedioic acid
Modify Date: 2025-11-25 21:46:43
butyl 2-methylprop-2-enoate,2-methylidenebutanedioic acid structure
|
Common Name | butyl 2-methylprop-2-enoate,2-methylidenebutanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 65379-39-7 | Molecular Weight | 272.29400 | |
| Density | N/A | Boiling Point | 160ºC at 760 mmHg | |
| Molecular Formula | C13H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 50.6ºC | |
| Name | butyl 2-methylprop-2-enoate,2-methylidenebutanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 160ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.29400 |
| Flash Point | 50.6ºC |
| Exact Mass | 272.12600 |
| PSA | 100.90000 |
| LogP | 2.00770 |
| InChIKey | PQUNWXLWYFNOSQ-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCCC.C=C(CC(=O)O)C(=O)O |
| Butanedioic acid,methylene-,polymer with butyl 2-methyl-2-propenoate |
| Butanedioic acid,2-methylene-,polymer with butyl 2-methyl-2-propenoate |
| Methacrylic acid,butyl ester,itaconic acid polymer |
| Butyl methacrylate,itaconic acid polymer |