2-hexyl-5-nitroisoindole-1,3-dione structure
|
Common Name | 2-hexyl-5-nitroisoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 65311-53-7 | Molecular Weight | 276.28800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hexyl-5-nitroisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O4 |
|---|---|
| Molecular Weight | 276.28800 |
| Exact Mass | 276.11100 |
| PSA | 83.20000 |
| LogP | 3.23220 |
| InChIKey | AQCRBKPPPRWDBR-UHFFFAOYSA-N |
| SMILES | CCCCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O |
|
~%
2-hexyl-5-nitro... CAS#:65311-53-7 |
| Literature: Billman; Cash Journal of the American Chemical Society, 1953 , vol. 75, p. 2499,2500 |
|
~%
2-hexyl-5-nitro... CAS#:65311-53-7 |
| Literature: Billman; Cash Journal of the American Chemical Society, 1953 , vol. 75, p. 2499,2500 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-N-n-hexylphthalimid |
| 2-Hexyl-5-nitro-isoindolin-1,3-dion |
| 2-hexyl-5-nitro-isoindoline-1,3-dione |
| 2-Hexyl-5-nitro-isoindole-1,3-dione |
| 2-hexyl-5-nitrobenzo[c]azoline-1,3-dione |