12-Chlorodehydroabietic acid structure
|
Common Name | 12-Chlorodehydroabietic acid | ||
|---|---|---|---|---|
| CAS Number | 65310-45-4 | Molecular Weight | 334.88000 | |
| Density | 1.132g/cm3 | Boiling Point | 445.4ºC at 760 mmHg | |
| Molecular Formula | C20H27ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
Use of 12-Chlorodehydroabietic acid12-Chlorodehydroabietic acid is a chlorinated resin acid[1]. |
| Name | 12-Chloroabieta-8(14),9(11),12-trien-18-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 12-Chlorodehydroabietic acid is a chlorinated resin acid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.132g/cm3 |
|---|---|
| Boiling Point | 445.4ºC at 760 mmHg |
| Molecular Formula | C20H27ClO2 |
| Molecular Weight | 334.88000 |
| Flash Point | 223.1ºC |
| Exact Mass | 334.17000 |
| PSA | 37.30000 |
| LogP | 5.55830 |
| Index of Refraction | 1.548 |
| InChIKey | LRHCLIUTYPHWLV-MISYRCLQSA-N |
| SMILES | CC(C)c1cc2c(cc1Cl)C1(C)CCCC(C)(C(=O)O)C1CC2 |
|
~%
12-Chlorodehydr... CAS#:65310-45-4 |
| Literature: Kutney; Dimitriadis Helvetica Chimica Acta, 1982 , vol. 65, # 5 p. 1351 - 1358 |
| 5,12-Naphthacenedione,11-chloro-2,6-dihydroxy |
| 12-chlorodehydroabietic acid |
| 12-chloro-5,9-dihydroxynaphthacene-6,11-dione |