Benzamide, N-(1,1-dimethylethyl)-3-phenoxy-
Modify Date: 2025-09-10 17:21:29
Benzamide, N-(1,1-dimethylethyl)-3-phenoxy- structure
|
Common Name | Benzamide, N-(1,1-dimethylethyl)-3-phenoxy- | ||
|---|---|---|---|---|
| CAS Number | 65261-11-2 | Molecular Weight | 269.33800 | |
| Density | 1.077g/cm3 | Boiling Point | 410.3ºC at 760 mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | N-tert-butyl-3-phenoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 410.3ºC at 760 mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 201.9ºC |
| Exact Mass | 269.14200 |
| PSA | 41.82000 |
| LogP | 4.58200 |
| Index of Refraction | 1.554 |
| InChIKey | NVPQPQCGSQCBKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)c1cccc(Oc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide, N-(1... CAS#:65261-11-2 |
| Literature: Sumitomo Patent: DE2720427 , 1977 ; Chem.Abstr., 1978 , vol. 88, # 120821 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzamide,N-(1,1-dimethylethyl)-3-phenoxy |
| N-t-Butyl-3-phenoxy-benzamid |