thallium(1+),3-(trifluoromethyl)benzoate
Modify Date: 2025-09-13 11:30:10
thallium(1+),3-(trifluoromethyl)benzoate structure
|
Common Name | thallium(1+),3-(trifluoromethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 6526-84-7 | Molecular Weight | 393.49500 | |
| Density | 1.324g/cm3 | Boiling Point | 396.8ºC at 760 mmHg | |
| Molecular Formula | C8H4F3O2Tl | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | thallium(1+),3-(trifluoromethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 396.8ºC at 760 mmHg |
| Molecular Formula | C8H4F3O2Tl |
| Molecular Weight | 393.49500 |
| Flash Point | 193.8ºC |
| Exact Mass | 393.99100 |
| PSA | 40.13000 |
| LogP | 1.06890 |
| Index of Refraction | 1.672 |
| InChIKey | XJERLXUZOIIQCJ-UHFFFAOYSA-N |
| SMILES | Fc1ccccc1NC(=S)NCc1ccncc1 |
|
~%
thallium(1+),3-... CAS#:6526-84-7 |
| Literature: Niculescu-Duvaz,I. et al. Canadian Journal of Chemistry, 1966 , vol. 44, p. 1102 - 1105 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzoic acid,m-trifluoromethyl-,thallium salt |
| Benzoic acid,3-(trifluoromethyl)-,thallium(1+) salt |