2-chloro-N,N-bis(2-hydroxyethyl)phenothiazine-10-carboxamide structure
|
Common Name | 2-chloro-N,N-bis(2-hydroxyethyl)phenothiazine-10-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 65240-94-0 | Molecular Weight | 364.84600 | |
| Density | 1.45g/cm3 | Boiling Point | 567.2ºC at 760 mmHg | |
| Molecular Formula | C17H17ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.8ºC | |
| Name | 2-chloro-N,N-bis(2-hydroxyethyl)phenothiazine-10-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 567.2ºC at 760 mmHg |
| Molecular Formula | C17H17ClN2O3S |
| Molecular Weight | 364.84600 |
| Flash Point | 296.8ºC |
| Exact Mass | 364.06500 |
| PSA | 89.31000 |
| LogP | 3.41430 |
| Index of Refraction | 1.685 |
| InChIKey | WOFGZPMVQMGMBV-UHFFFAOYSA-N |
| SMILES | O=C(N(CCO)CCO)N1c2ccccc2Sc2ccc(Cl)cc21 |
|
~%
2-chloro-N,N-bi... CAS#:65240-94-0 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
| 2-chloro-phenothiazine-10-carboxylic acid bis-(2-hydroxy-ethyl)-amide |
| N,N-Bis(2-hydroxyethyl)-2-chloro-10H-phenothiazine-10-carboxamide |
| 10H-Phenothiazine-10-carboxamide,N,N-bis(2-hydroxyethyl)-2-chloro |