dimethyl 5-hydroxy-3-methoxybenzene-1,2-dicarboxylate
Modify Date: 2025-11-22 12:32:13
dimethyl 5-hydroxy-3-methoxybenzene-1,2-dicarboxylate structure
|
Common Name | dimethyl 5-hydroxy-3-methoxybenzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 65212-19-3 | Molecular Weight | 240.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 5-hydroxy-3-methoxybenzene-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O6 |
|---|---|
| Molecular Weight | 240.20900 |
| Exact Mass | 240.06300 |
| PSA | 82.06000 |
| LogP | 0.97400 |
| InChIKey | VDCCQCMRKQBMRS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)cc(OC)c1C(=O)OC |
|
~%
dimethyl 5-hydr... CAS#:65212-19-3 |
| Literature: Danishefsky,S. et al. Journal of the American Chemical Society, 1979 , vol. 101, p. 7001 - 7008 |
|
~%
dimethyl 5-hydr... CAS#:65212-19-3 |
| Literature: Hemmelmayr; Meyer Monatshefte fuer Chemie, 1925 , vol. 46, p. 155 |
| 4-Oxy-6-methoxy-isophthalsaeure-dimethylester |
| Dimethyl-3-methoxy-5-hydroxyphthalat |
| dimethyl 5-hydroxy-3-methoxyphthalate |
| 4-hydroxy-6-methoxy-phthalic acid dimethyl ester |
| 1,2-Benzenedicarboxylic acid,5-hydroxy-3-methoxy-,dimethyl ester |
| 4-Hydroxy-6-methoxy-phthalsaeure-dimethylester |
| Dimethyl-4-hydroxy-6-methoxy-phthalat |