1-(2,4-Dimethylphenyl)-3-(4-(2-methoxyphenyl)-1-piperazinyl)-2-propen- 1-one structure
|
Common Name | 1-(2,4-Dimethylphenyl)-3-(4-(2-methoxyphenyl)-1-piperazinyl)-2-propen- 1-one | ||
|---|---|---|---|---|
| CAS Number | 65201-18-5 | Molecular Weight | 350.45400 | |
| Density | 1.15g/cm3 | Boiling Point | 524.3ºC at 760 mmHg | |
| Molecular Formula | C22H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.9ºC | |
| Name | 1-(2,4-dimethylphenyl)-3-[4-(2-methoxyphenyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 524.3ºC at 760 mmHg |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.45400 |
| Flash Point | 270.9ºC |
| Exact Mass | 350.19900 |
| PSA | 32.78000 |
| LogP | 3.83350 |
| Index of Refraction | 1.62 |
| InChIKey | OYCDBXYALFDSKZ-ZHACJKMWSA-N |
| SMILES | COc1ccccc1N1CCN(C=CC(=O)c2ccc(C)cc2C)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2,4-Dimethylphenyl)-3-(4-(2-methoxyphenyl)-1-piperazinyl)-2-propen-1-one |
| 1-(2,4-dimethyl-phenyl)-3-[4-(2-methoxy-phenyl)-piperazin-1-yl]-propenone |
| 2-Propen-1-one,1-(2,4-dimethylphenyl)-3-[4-(2-methoxyphenyl)-1-piperazinyl] |