2-methylharmine
Modify Date: 2025-12-03 13:10:22
2-methylharmine structure
|
Common Name | 2-methylharmine | ||
|---|---|---|---|---|
| CAS Number | 6519-18-2 | Molecular Weight | 328.40900 | |
| Density | 1.17g/cm3 | Boiling Point | 446.2ºC at 760 mmHg | |
| Molecular Formula | C18H24N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.6ºC | |
| Name | N2-methylharmine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 446.2ºC at 760 mmHg |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.40900 |
| Flash Point | 223.6ºC |
| Exact Mass | 328.19000 |
| PSA | 50.72000 |
| LogP | 2.12730 |
| Index of Refraction | 1.618 |
| InChIKey | SNPOLGTUMADPOR-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3ccn(C)c(C)c-3nc2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-methylharmine |
| N(2)-methylharmine |
| 1-(3,4-Dimethoxybenzyl)-1-(2-(3-methylpyrazinyl))piperazine |
| Piperazine,1-(3,4-dimethoxybenzyl)-1-(2-(3-methylpyrazinyl)) |
| 2-[4-[(3,4-dimethoxyphenyl)methyl]piperazin-1-yl]-3-methylpyrazine |
| 2-methyl-2H-harmine |
| 2-[4-(3,4-dimethoxybenzyl)piperazin-1-yl]-3-methylpyrazine |