6-methyl-5-nitropicolinonitrile
Modify Date: 2025-10-08 13:55:37
6-methyl-5-nitropicolinonitrile structure
|
Common Name | 6-methyl-5-nitropicolinonitrile | ||
|---|---|---|---|---|
| CAS Number | 65169-58-6 | Molecular Weight | 163.13300 | |
| Density | 1.34g/cm3 | Boiling Point | 338ºC at 760 mmHg | |
| Molecular Formula | C7H5N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.2ºC | |
| Name | 6-Methyl-5-nitropicolinonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 338ºC at 760 mmHg |
| Molecular Formula | C7H5N3O2 |
| Molecular Weight | 163.13300 |
| Flash Point | 158.2ºC |
| Exact Mass | 163.03800 |
| PSA | 82.50000 |
| LogP | 1.69308 |
| Index of Refraction | 1.57 |
| InChIKey | BOQXPAKRNJXZFB-UHFFFAOYSA-N |
| SMILES | Cc1nc(C#N)ccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~%
6-methyl-5-nitr... CAS#:65169-58-6 |
| Literature: US2005/281746 A1, ; Page/Page column 15-16 ; |
|
~%
6-methyl-5-nitr... CAS#:65169-58-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 5 p. 795 - 798 |
|
~%
6-methyl-5-nitr... CAS#:65169-58-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 13, # 5 p. 795 - 798 |
![(1H-pyrrolo[3,2-b]pyridin-5-yl)methanamine structure](https://image.chemsrc.com/caspic/074/267876-26-6.png)
CAS#:267876-26-6| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-5-nitropyridine-2-carbonitrile |