3,4-Dimethyl-5-nitro-2(1H)-pyridinone structure
|
Common Name | 3,4-Dimethyl-5-nitro-2(1H)-pyridinone | ||
|---|---|---|---|---|
| CAS Number | 65169-34-8 | Molecular Weight | 168.150 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 323.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.4±25.9 °C | |
| Name | 3,4-dimethyl-5-nitro-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 323.5±35.0 °C at 760 mmHg |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.150 |
| Flash Point | 149.4±25.9 °C |
| Exact Mass | 168.053497 |
| PSA | 78.94000 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | OYAVUDSYTOBZEY-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])c[nH]c(=O)c1C |
| HS Code | 2933399090 |
|---|
|
~60%
3,4-Dimethyl-5-... CAS#:65169-34-8 |
| Literature: Straub Synthetic Communications, 1993 , vol. 23, # 3 p. 365 - 372 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2(1H)-Pyridinone, 3,4-dimethyl-5-nitro- |
| 2-Hydroxy-3,4-dimethyl-5-nitropyridin |
| 3,4-dimethyl-5-nitropyridin-2-ol |
| 3,4-Dimethyl-5-nitropyridin-2(1H)-one |
| 3,4-Dimethyl-5-nitro-2(1H)-pyridinone |
| 3,4-dimethyl-5-nitro-2-pyridinol |
| 2(1H)-Pyridinone,3,4-dimethyl-5-nitro |
| 3,4-dimethyl-2-hydroxy-5-nitropyridine |