9-(1,1-dimethylethyl)-1,5-dioxaspiro[5.5]undecane structure
|
Common Name | 9-(1,1-dimethylethyl)-1,5-dioxaspiro[5.5]undecane | ||
|---|---|---|---|---|
| CAS Number | 65156-97-0 | Molecular Weight | 212.32800 | |
| Density | 0.96g/cm3 | Boiling Point | 256.6ºC at 760 mmHg | |
| Molecular Formula | C13H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 100.4ºC | |
| Name | 9-tert-butyl-1,5-dioxaspiro[5.5]undecane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.96g/cm3 |
|---|---|
| Boiling Point | 256.6ºC at 760 mmHg |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.32800 |
| Flash Point | 100.4ºC |
| Exact Mass | 212.17800 |
| PSA | 18.46000 |
| LogP | 3.35590 |
| Index of Refraction | 1.473 |
| InChIKey | DVDNSLYHRDSWHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC2(CC1)OCCCO2 |
| HS Code | 2932999099 |
|---|
|
~85%
9-(1,1-dimethyl... CAS#:65156-97-0 |
| Literature: Furuta, Kyoji; Nagata, Takushi; Yamamoto, Hisashi Tetrahedron Letters, 1988 , vol. 29, # 18 p. 2215 - 2218 |
|
~72%
9-(1,1-dimethyl... CAS#:65156-97-0 |
| Literature: Curini; Epifano; Marcotullio; Rosati Synlett, 2001 , # 7 p. 1182 - 1184 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 265-577-5 |
| 9-tert-butyl-1,5-dioxa-spiro[5.5]undecane |
| 9-t-butyl-1,5-dioxaspiro<5.5>undecane |
| 9-(1,1-Dimethylethyl)-1,5-dioxaspiro[5.5]undecane |
| 4-tert-Butylcyclohexanone |