6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]azo]naphthalene-2-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) structure
|
Common Name | 6-amino-4-hydroxy-5-[[2-(trifluoromethyl)phenyl]azo]naphthalene-2-sulphonic acid, compound with 2,2'-iminodiethanol (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65152-19-4 | Molecular Weight | 516.49100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23F3N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxyethylamino)ethanol,6-imino-4-oxo-5-[2-[2-(trifluoromethyl)phenyl]hydrazinyl]naphthalene-2-sulfonic acid |
|---|
| Molecular Formula | C21H23F3N4O6S |
|---|---|
| Molecular Weight | 516.49100 |
| Exact Mass | 516.12900 |
| PSA | 180.22000 |
| LogP | 3.34230 |
| InChIKey | MEYSBXLLIAMVOA-UHFFFAOYSA-N |
| SMILES | Nc1ccc2cc(S(=O)(=O)[O-])cc(O)c2c1N=Nc1ccccc1C(F)(F)F.OCC[NH2+]CCO |