10-(sulphooxy)octadecanoic acid
Modify Date: 2024-01-18 08:09:22
10-(sulphooxy)octadecanoic acid structure
|
Common Name | 10-(sulphooxy)octadecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 65151-74-8 | Molecular Weight | 380.54000 | |
| Density | 1.101g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H36O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-sulfooxyoctadecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.101g/cm3 |
|---|---|
| Molecular Formula | C18H36O6S |
| Molecular Weight | 380.54000 |
| Exact Mass | 380.22300 |
| PSA | 109.28000 |
| LogP | 6.21120 |
| Index of Refraction | 1.485 |
| InChIKey | UTCQDHSSQWLJPP-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CCCCCCCCC(=O)O)OS(=O)(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Stearic acid sulfate ester |
| EINECS 265-548-7 |
| Octadecanoic acid,10-(sulfooxy) |
| 10-sulfonooxy-octadecanoic acid |
| Stearinschwefelsaeure |
| 10-(sulfooxy)octadecanoic acid |
| 10-(Sulphooxy)octadecanoic acid |
| Sulfo-oxystearinsaeure |
| sulfo-oxystearic acid |