5-methyl-1-trimethylsilylhex-1-yn-3-one structure
|
Common Name | 5-methyl-1-trimethylsilylhex-1-yn-3-one | ||
|---|---|---|---|---|
| CAS Number | 65149-29-3 | Molecular Weight | 182.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-1-trimethylsilylhex-1-yn-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H18OSi |
|---|---|
| Molecular Weight | 182.33500 |
| Exact Mass | 182.11300 |
| PSA | 17.07000 |
| LogP | 2.48240 |
| InChIKey | LJFJYYACSFXATL-UHFFFAOYSA-N |
| SMILES | CC(C)CC(=O)C#C[Si](C)(C)C |
|
~%
5-methyl-1-trim... CAS#:65149-29-3 |
| Literature: Heiss, Christian; Phillips, Robert S. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 16 p. 2821 - 2825 |
|
~%
5-methyl-1-trim... CAS#:65149-29-3 |
| Literature: Yogo, T.; Koshino, J.; Suzuki, A. Synthetic Communications, 1981 , vol. 11, # 9 p. 769 - 774 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Hexyn-3-one,5-methyl-1-(trimethylsilyl) |
| 5-Methyl-1-(trimethylsilyl)-1-hexyn-3-one |