N-[4-methoxy-2-[(4-methylphenyl)sulfonylamino]phenyl]acetamide structure
|
Common Name | N-[4-methoxy-2-[(4-methylphenyl)sulfonylamino]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 65145-73-5 | Molecular Weight | 334.39000 | |
| Density | 1.327g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-methoxy-2-[(4-methylphenyl)sulfonylamino]phenyl]acetamide |
|---|
| Density | 1.327g/cm3 |
|---|---|
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.39000 |
| Exact Mass | 334.09900 |
| PSA | 92.88000 |
| LogP | 3.98960 |
| Index of Refraction | 1.615 |
| InChIKey | TWEGRXQEMCDMTP-UHFFFAOYSA-N |
| SMILES | COc1ccc(NC(C)=O)c(NS(=O)(=O)c2ccc(C)cc2)c1 |
|
~%
N-[4-methoxy-2-... CAS#:65145-73-5 |
| Literature: Elderfield et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1589 |
|
~%
N-[4-methoxy-2-... CAS#:65145-73-5 |
| Literature: Elderfield et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1589 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |