dipivaloylisoproterenol
Modify Date: 2025-08-23 19:33:39
dipivaloylisoproterenol structure
|
Common Name | dipivaloylisoproterenol | ||
|---|---|---|---|---|
| CAS Number | 65114-85-4 | Molecular Weight | 379.49000 | |
| Density | 1.073g/cm3 | Boiling Point | 493.1ºC at 760 mmHg | |
| Molecular Formula | C21H33NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252ºC | |
| Name | [2-(2,2-dimethylpropanoyloxy)-4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 493.1ºC at 760 mmHg |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.49000 |
| Flash Point | 252ºC |
| Exact Mass | 379.23600 |
| PSA | 84.86000 |
| LogP | 4.01190 |
| Index of Refraction | 1.506 |
| InChIKey | CBSXCMCOPDQXAD-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)c1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diyl bis(2,2-dimethylpropanoate) |
| Dipivaloylisoproterenol |
| Dipivalylisoproterenol |