S-(4-nitrophenyl) 2,2-dimethylpropanethioate structure
|
Common Name | S-(4-nitrophenyl) 2,2-dimethylpropanethioate | ||
|---|---|---|---|---|
| CAS Number | 65114-72-9 | Molecular Weight | 239.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-(4-nitrophenyl) 2,2-dimethylpropanethioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13NO3S |
|---|---|
| Molecular Weight | 239.29100 |
| Exact Mass | 239.06200 |
| PSA | 88.19000 |
| LogP | 3.78280 |
| InChIKey | VIRQJTNJAZTUBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Sc1ccc([N+](=O)[O-])cc1 |
|
~%
S-(4-nitropheny... CAS#:65114-72-9 |
| Literature: Hupe,D.J. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 7659 - 7662 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Nitro-thiophenyl-pivalat |
| p-nitrothiophenyl pivalate |
| Propanethioic acid,2,2-dimethyl-,S-(4-nitrophenyl) ester |