1-(trichloromethyl)-2-(trifluoromethyl)benzene structure
|
Common Name | 1-(trichloromethyl)-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 651-36-5 | Molecular Weight | 263.47200 | |
| Density | 1.511g/cm3 | Boiling Point | 232.7ºC at 760 mmHg | |
| Molecular Formula | C8H4Cl3F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110.3ºC | |
| Name | 1-(trichloromethyl)-2-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.511g/cm3 |
|---|---|
| Boiling Point | 232.7ºC at 760 mmHg |
| Molecular Formula | C8H4Cl3F3 |
| Molecular Weight | 263.47200 |
| Flash Point | 110.3ºC |
| Exact Mass | 261.93300 |
| LogP | 4.53210 |
| Index of Refraction | 1.488 |
| InChIKey | VDEUYVGUNSJXAE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccccc1C(Cl)(Cl)Cl |
| HS Code | 2903999090 |
|---|
|
~%
1-(trichloromet... CAS#:651-36-5 |
| Literature: Fernandez-Bolanos,J. et al. Journal of the Chemical Society, 1960 , p. 4003 - 4010 |
|
~%
1-(trichloromet... CAS#:651-36-5 |
| Literature: Fernandez-Bolanos,J. et al. Journal of the Chemical Society, 1960 , p. 4003 - 4010 |
| Precursor 2 | |
|---|---|
| DownStream 8 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| trichloromethyl-trifluoromethyl-benzene |
| EINECS 211-481-3 |
| 2-Trichlormethyl-benzotrifluorid |
| Benzene,1-(trichloromethyl)-2-(trifluoromethyl) |