N,N'-(9-Oxo-9H-fluorene-2,7-diyl)bis[2-(dipropylamino)acetamide] structure
|
Common Name | N,N'-(9-Oxo-9H-fluorene-2,7-diyl)bis[2-(dipropylamino)acetamide] | ||
|---|---|---|---|---|
| CAS Number | 65091-40-9 | Molecular Weight | 235.19600 | |
| Density | 1.163g/cm3 | Boiling Point | 712.3ºC at 760mmHg | |
| Molecular Formula | C10H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.6ºC | |
| Name | (5R)-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 712.3ºC at 760mmHg |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.19600 |
| Flash Point | 384.6ºC |
| Exact Mass | 235.05900 |
| PSA | 111.00000 |
| LogP | 1.08850 |
| Index of Refraction | 1.603 |
| InChIKey | LWCCLNCBOJNHFX-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CC(=O)Nc1ccc2c(c1)C(=O)c1cc(NC(=O)CN(CCC)CCC)ccc1-2 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |