ethyl 4-(4-chlorophenyl)sulfonylbenzoate structure
|
Common Name | ethyl 4-(4-chlorophenyl)sulfonylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 65082-46-4 | Molecular Weight | 324.77900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(4-chlorophenyl)sulfonylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClO4S |
|---|---|
| Molecular Weight | 324.77900 |
| Exact Mass | 324.02200 |
| PSA | 68.82000 |
| LogP | 4.43030 |
| InChIKey | NMLCKGRLTLGYAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
|
~%
ethyl 4-(4-chlo... CAS#:65082-46-4 |
| Literature: Buehler; Masters Journal of Organic Chemistry, 1939 , vol. 4, p. 262,264 |
|
~%
ethyl 4-(4-chlo... CAS#:65082-46-4 |
| Literature: Buehler; Masters Journal of Organic Chemistry, 1939 , vol. 4, p. 262,264 |
| 4-(4-Chlor-phenylsulfon)-benzoesaeure-aethylester |
| 4-(4-Chlor-benzolsulfonyl)-benzoesaeure-aethylester |
| 4-(4-chloro-benzenesulfonyl)-benzoic acid ethyl ester |
| Benzoic acid,4-[(4-chlorophenyl)sulfonyl]-,ethyl ester |