1,3-Dioxolane-2,2-diaceticacid, 2,2-dimethyl ester
Modify Date: 2025-10-05 16:43:47
1,3-Dioxolane-2,2-diaceticacid, 2,2-dimethyl ester structure
|
Common Name | 1,3-Dioxolane-2,2-diaceticacid, 2,2-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6506-31-6 | Molecular Weight | 218.20400 | |
| Density | 1.183g/cm3 | Boiling Point | 266.1ºC at 760 mmHg | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.8ºC | |
| Name | methyl 2-[2-(2-methoxy-2-oxoethyl)-1,3-dioxolan-2-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 266.1ºC at 760 mmHg |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20400 |
| Flash Point | 111.8ºC |
| Exact Mass | 218.07900 |
| PSA | 71.06000 |
| Index of Refraction | 1.438 |
| InChIKey | LVAUHOGCZGDDIX-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(CC(=O)OC)OCCO1 |
| HS Code | 2932999099 |
|---|
|
~88%
1,3-Dioxolane-2... CAS#:6506-31-6 |
| Literature: Yadav; Bandyopadhyay; Kunwar Tetrahedron Letters, 2001 , vol. 42, # 29 p. 4907 - 4911 |
CAS#:5694-95-1![methyl 2-[2-(2-oxoethyl)-1,3-dioxolan-2-yl]acetate structure](https://image.chemsrc.com/caspic/238/96725-02-9.png)
CAS#:96725-02-9| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 3-ethylendioxyglutarat |
| 1,3-Dioxolan-acetondicarbonsaeure-methylester |
| dimethyl 1,3-acetonedicarboxylate ethylene acetal |
| dimethyl acetonedicarboxylate ethylene ketal |
| Methyl-3-ethylenedioxyglutarat |