decyl 2-nitrobenzoate
Modify Date: 2024-01-09 11:40:00
decyl 2-nitrobenzoate structure
|
Common Name | decyl 2-nitrobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6500-28-3 | Molecular Weight | 307.38500 | |
| Density | 1.068g/cm3 | Boiling Point | 402.1ºC at 760 mmHg | |
| Molecular Formula | C17H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.6ºC | |
| Name | decyl 2-nitrobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.068g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760 mmHg |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.38500 |
| Flash Point | 142.6ºC |
| Exact Mass | 307.17800 |
| PSA | 72.12000 |
| LogP | 5.41550 |
| Index of Refraction | 1.511 |
| InChIKey | SJJAUALFDHHSCH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC(=O)c1ccccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 229-381-3 |
| Benzoic acid,2-nitro-,decyl ester |
| Benzoicacid,o-nitro-,decyl ester (7CI,8CI) |