2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole
Modify Date: 2025-09-12 06:15:22
2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole structure
|
Common Name | 2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 64995-45-5 | Molecular Weight | 237.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4F5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,1,2,2,2-pentafluoroethyl)-1,3-benzoxazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H4F5NO |
|---|---|
| Molecular Weight | 237.12600 |
| Exact Mass | 237.02100 |
| PSA | 26.03000 |
| LogP | 3.48190 |
| InChIKey | FIUVELGQLQIVJG-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)c1nc2ccccc2o1 |
|
~%
2-(1,1,2,2,2-pe... CAS#:64995-45-5 |
| Literature: Ishikawa,N.; Sasaki,S. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 2164 - 2167 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-(Pentafluoroethyl)benzoxazol |
| Benzoxazole,2-(pentafluoroethyl) |
| 2-pentafluoroethyl-benzooxazole |