[1,1'-Biphenyl]-4-amine,N,N-bis(2-bromoethyl)- structure
|
Common Name | [1,1'-Biphenyl]-4-amine,N,N-bis(2-bromoethyl)- | ||
|---|---|---|---|---|
| CAS Number | 64977-16-8 | Molecular Weight | 383.12100 | |
| Density | 1.519g/cm3 | Boiling Point | 456.2ºC at 760 mmHg | |
| Molecular Formula | C16H17Br2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.7ºC | |
| Name | N,N-bis(2-bromoethyl)-4-phenylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.519g/cm3 |
|---|---|
| Boiling Point | 456.2ºC at 760 mmHg |
| Molecular Formula | C16H17Br2N |
| Molecular Weight | 383.12100 |
| Flash Point | 229.7ºC |
| Exact Mass | 380.97300 |
| PSA | 3.24000 |
| LogP | 4.94980 |
| Index of Refraction | 1.631 |
| InChIKey | ZXBKJPIOQUIDCZ-UHFFFAOYSA-N |
| SMILES | BrCCN(CCBr)c1ccc(-c2ccccc2)cc1 |
|
~%
[1,1'-Biphenyl]... CAS#:64977-16-8 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| N,N-BIS(2-BROMOETHYL)-4-PHENYL-ANILINE |
| biphenyl-4-yl-bis-(2-bromo-ethyl)-amine |
| Biphenyl-4-yl-bis-(2-brom-aethyl)-amin |
| [1,1'-Biphenyl]-4-amine,N,N-bis(2-bromoethyl) |