Benzenebutanal,4-[bis(2-chloroethyl)amino]- structure
|
Common Name | Benzenebutanal,4-[bis(2-chloroethyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 64977-05-5 | Molecular Weight | 288.21300 | |
| Density | 1.169g/cm3 | Boiling Point | 423.2ºC at 760mmHg | |
| Molecular Formula | C14H19Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.7ºC | |
| Name | 4-[4-[bis(2-chloroethyl)amino]phenyl]butanal |
|---|
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 423.2ºC at 760mmHg |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.21300 |
| Flash Point | 209.7ºC |
| Exact Mass | 287.08400 |
| PSA | 20.31000 |
| LogP | 3.49220 |
| Index of Refraction | 1.55 |
| InChIKey | HUIZMVVIRCIOPG-UHFFFAOYSA-N |
| SMILES | O=CCCCc1ccc(N(CCCl)CCCl)cc1 |
|
~72%
Benzenebutanal,... CAS#:64977-05-5 |
| Literature: WISCONSIN ALUMNI RESEARCH FOUNDATION Patent: US2012/94946 A1, 2012 ; Location in patent: Page/Page column 18 ; |
|
~71%
Benzenebutanal,... CAS#:64977-05-5 |
| Literature: Auckland Division Cancer Society of New Zealand Inc.; Circadian Pharmaceuticals (Australia) Pty. Ltd. Patent: US5968933 A1, 1999 ; |
|
~%
Benzenebutanal,... CAS#:64977-05-5 |
| Literature: Gravatt; Baguley; Wilson; Denny Journal of Medicinal Chemistry, 1994 , vol. 37, # 25 p. 4338 - 4345 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |