Acetic acid,2-[3-[bis(2-chloroethyl)amino]phenoxy]-, ethyl ester structure
|
Common Name | Acetic acid,2-[3-[bis(2-chloroethyl)amino]phenoxy]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 64976-95-0 | Molecular Weight | 320.21200 | |
| Density | 1.23g/cm3 | Boiling Point | 412.2ºC at 760 mmHg | |
| Molecular Formula | C14H19Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.1ºC | |
| Name | (m--phenoxy)-essigsaeure-ethylester |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 412.2ºC at 760 mmHg |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.21200 |
| Flash Point | 203.1ºC |
| Exact Mass | 319.07400 |
| PSA | 38.77000 |
| LogP | 2.91250 |
| Index of Refraction | 1.541 |
| InChIKey | LJMICDABNMOLOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1cccc(N(CCCl)CCCl)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |