7-[3-(2-methyl-1,3-dioxolan-2-yl)propoxy]chromen-2-one structure
|
Common Name | 7-[3-(2-methyl-1,3-dioxolan-2-yl)propoxy]chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 649559-19-3 | Molecular Weight | 290.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-[3-(2-methyl-1,3-dioxolan-2-yl)propoxy]chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O5 |
|---|---|
| Molecular Weight | 290.31100 |
| Exact Mass | 290.11500 |
| PSA | 57.90000 |
| LogP | 2.71500 |
| InChIKey | IYIAWSSPFIVVRK-UHFFFAOYSA-N |
| SMILES | CC1(CCCOc2ccc3ccc(=O)oc3c2)OCCO1 |
|
~73%
7-[3-(2-methyl-... CAS#:649559-19-3 |
| Literature: Gutierrez, Maria C.; Sleegers, Arthur; Simpson, Helen D.; Alphand, Veronique; Furstoss, Roland Organic and Biomolecular Chemistry, 2003 , vol. 1, # 20 p. 3500 - 3506 |
|
~%
7-[3-(2-methyl-... CAS#:649559-19-3 |
| Literature: Gutierrez, Maria C.; Sleegers, Arthur; Simpson, Helen D.; Alphand, Veronique; Furstoss, Roland Organic and Biomolecular Chemistry, 2003 , vol. 1, # 20 p. 3500 - 3506 |
| 2H-1-Benzopyran-2-one,7-[3-(2-methyl-1,3-dioxolan-2-yl)propoxy] |
| 7-[(4,4-ethylenedioxy)pentoxy]-2H-1-benzopyran-2-one |