Glycolithocholic acid 3-sulfate disodium structure
|
Common Name | Glycolithocholic acid 3-sulfate disodium | ||
|---|---|---|---|---|
| CAS Number | 64936-82-9 | Molecular Weight | 557.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H41NNa2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glycolithocholic acid 3-sulfate disodiumGlycolithocholic acid 3-sulfate (disodium) inhibits replication of HIV-1 in vitro. Glycolithocholic acid 3-sulfate (disodium) can be used for the research of HIV infection and gallbladder disease[1][2]. |
| Name | 3alpha-hydroxy-5beta-cholan 24-oic acid n-[carboxymethyl]amide 3-sulfate disodium salt |
|---|
| Description | Glycolithocholic acid 3-sulfate (disodium) inhibits replication of HIV-1 in vitro. Glycolithocholic acid 3-sulfate (disodium) can be used for the research of HIV infection and gallbladder disease[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H41NNa2O7S |
|---|---|
| Molecular Weight | 557.65 |
| InChIKey | HKKXGSBTGBBCHS-LGURPPGFSA-N |
| SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CCC4CC(OS(=O)(=O)O)CCC4(C)C3CCC12C.[Na] |
| WGK Germany | 3 |
|---|