ethyl 3-acetyloxy-3-phenylprop-2-enoate structure
|
Common Name | ethyl 3-acetyloxy-3-phenylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 64932-47-4 | Molecular Weight | 234.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-acetyloxy-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O4 |
|---|---|
| Molecular Weight | 234.24800 |
| Exact Mass | 234.08900 |
| PSA | 52.60000 |
| LogP | 2.15370 |
| InChIKey | CAHPEYNELBHXTB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C=C(OC(C)=O)c1ccccc1 |
|
~%
ethyl 3-acetylo... CAS#:64932-47-4 |
| Literature: Vineyard,B.D. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 5946 - 5952 |
|
~%
ethyl 3-acetylo... CAS#:64932-47-4 |
| Literature: Monsanto Company Patent: US4194051 A1, 1980 ; |
|
~%
ethyl 3-acetylo... CAS#:64932-47-4 |
| Literature: Vineyard,B.D. et al. Journal of the American Chemical Society, 1977 , vol. 99, p. 5946 - 5952 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Propenoic acid,3-(acetyloxy)-3-phenyl-,ethyl ester |
| (Z)-ethyl 3-acetyloxy-3-phenyl-2-propenoate |
| E-3-Acetoxy-3-phenylpropensaeureethylester |
| Aethyl-3-Acetyloxy-3-phenyl-2-propenoat(E-Form) |
| 2-Propenoic acid,3-(acetyloxy)-3-phenyl-,ethyl ester,(E) |