(3,4-dichloro-3,4,4-trifluoro-1-iodobutyl)-trimethylsilane structure
|
Common Name | (3,4-dichloro-3,4,4-trifluoro-1-iodobutyl)-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 649-66-1 | Molecular Weight | 379.06100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H12Cl2F3ISi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,4-dichloro-3,4,4-trifluoro-1-iodobutyl)-trimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H12Cl2F3ISi |
|---|---|
| Molecular Weight | 379.06100 |
| Exact Mass | 377.90800 |
| LogP | 5.21360 |
| InChIKey | CKAINWCJUNQPOI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C(I)CC(F)(Cl)C(F)(F)Cl |
|
~%
(3,4-dichloro-3... CAS#:649-66-1 |
| Literature: Geyer et al. Journal of the Chemical Society, 1957 , p. 4472,4479 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Silane,(3,4-dichloro-3,4,4-trifluoro-1-iodobutyl)trimethyl |
| (3,4-Dichlor-3,4,4-trifluor-1-jod-butyl)-trimethyl-silan |
| (3,4-dichloro-3,4,4-trifluoro-1-iodo-butyl)-trimethyl-silane |