caricotamide
Modify Date: 2025-09-20 16:44:25
caricotamide structure
|
Common Name | caricotamide | ||
|---|---|---|---|---|
| CAS Number | 64881-21-6 | Molecular Weight | 181.19200 | |
| Density | 1.304g/cm3 | Boiling Point | 499.6ºC at 760 mmHg | |
| Molecular Formula | C8H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.9ºC | |
| Name | 1-(2-amino-2-oxoethyl)-4H-pyridine-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 499.6ºC at 760 mmHg |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19200 |
| Flash Point | 255.9ºC |
| Exact Mass | 181.08500 |
| PSA | 91.40000 |
| LogP | 1.29760 |
| Index of Refraction | 1.589 |
| InChIKey | WEJRSYKFMCUCRQ-UHFFFAOYSA-N |
| SMILES | NC(=O)CN1C=CCC(C(N)=O)=C1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1(4h)-pyridineacetamide,3-(aminocarbonyl) |
| Caricotamide |
| UNII-MC09H30MFS |
| Prolarix |