Etisulergine
Modify Date: 2025-09-10 18:57:05
Etisulergine structure
|
Common Name | Etisulergine | ||
|---|---|---|---|---|
| CAS Number | 64795-23-9 | Molecular Weight | 376.51600 | |
| Density | 1.31g/cm3 | Boiling Point | 561.6ºC at 760 mmHg | |
| Molecular Formula | C19H28N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.4ºC | |
| Name | Etisulergine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 561.6ºC at 760 mmHg |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.51600 |
| Flash Point | 293.4ºC |
| Exact Mass | 376.19300 |
| PSA | 76.82000 |
| LogP | 3.46610 |
| Index of Refraction | 1.654 |
| InChIKey | YHEIHLVIKSTGJE-YXJHDRRASA-N |
| SMILES | CCN(CC)S(=O)(=O)NC1CC2c3cccc4[nH]cc(c34)CC2N(C)C1 |
|
~%
Etisulergine CAS#:64795-23-9 |
| Literature: Stutz; Stadler; Vigouret; Jaton European Journal of Medicinal Chemistry, 1982 , vol. 17, # 6 p. 537 - 541 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,7,12,18-Tetraaethyl-3,8,13,17-tetramethyl-porphyrin |
| Etioporphyrin 3 |
| N,N-diethyl-N'-(6-methyl-ergolin-8-yl)-sulfamide |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-porphyrin |
| aetioporphyrin-III |
| 3,8,13,17-tetraethyl-2,7,12,18-tetramethylporphyrin |
| 2,7,12,18-Tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphyrin |
| 2,7,12,18-tetraethyl-3,8,13,17-tetramethyl-21H,23H-porphine |