methyl 8-iodo-4,5,7-trimethoxynaphthalene-2-carboxylate
Modify Date: 2025-11-03 17:30:35
methyl 8-iodo-4,5,7-trimethoxynaphthalene-2-carboxylate structure
|
Common Name | methyl 8-iodo-4,5,7-trimethoxynaphthalene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 64766-44-5 | Molecular Weight | 402.18100 | |
| Density | 1.573g/cm3 | Boiling Point | 488.1ºC at 760 mmHg | |
| Molecular Formula | C15H15IO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249ºC | |
| Name | methyl 8-iodo-4,5,7-trimethoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 488.1ºC at 760 mmHg |
| Molecular Formula | C15H15IO5 |
| Molecular Weight | 402.18100 |
| Flash Point | 249ºC |
| Exact Mass | 401.99600 |
| PSA | 53.99000 |
| LogP | 3.25680 |
| Index of Refraction | 1.611 |
| InChIKey | IKBDWDGZPCUZDD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)cc(OC)c(I)c2c1 |
|
~81%
methyl 8-iodo-4... CAS#:64766-44-5 |
| Literature: Cameron, Donald W.; Feutrill, Geoffrey I.; Pannan, Linda J. H. Australian Journal of Chemistry, 1980 , vol. 33, # 11 p. 2531 - 2541 |
![dimethyl 2,2',4,4',5,5'-hexamethoxy[1,1'-binaphthalene]-7,7'-dicarboxylate structure](https://image.chemsrc.com/caspic/208/74694-99-8.png)
CAS#:74694-99-8![dimethyl 4-hydroxy-2,2',4',5,5'-pentamethoxy-[1,1'-binaphthalene]-7,7'-dicarboxylate structure](https://image.chemsrc.com/caspic/358/77729-59-0.png)
CAS#:77729-59-0
CAS#:77729-58-9
CAS#:77729-61-4
CAS#:78395-64-9| methyl 8-iodo-4,5,7-trimethoxy-2-naphthoate |
| Methyl-8-iod-4,5,7-trimethoxy-2-naphtoat |
| 2-Naphthalenecarboxylic acid,8-iodo-4,5,7-trimethoxy-,methyl ester |