4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol
Modify Date: 2025-11-25 19:19:42
4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol structure
|
Common Name | 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 647-84-7 | Molecular Weight | 354.00500 | |
| Density | 1.939g/cm3 | Boiling Point | 165.2ºC at 760 mmHg | |
| Molecular Formula | C6H6F7IO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 53.7ºC | |
| Name | 4,4,5,5,6,6,6-heptafluoro-2-iodohexan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.939g/cm3 |
|---|---|
| Boiling Point | 165.2ºC at 760 mmHg |
| Molecular Formula | C6H6F7IO |
| Molecular Weight | 354.00500 |
| Flash Point | 53.7ºC |
| Exact Mass | 353.93500 |
| PSA | 20.23000 |
| LogP | 3.00530 |
| Index of Refraction | 1.411 |
| InChIKey | ITASBCIXGRCUAD-UHFFFAOYSA-N |
| SMILES | OCC(I)CC(F)(F)C(F)(F)C(F)(F)F |
|
~50%
4,4,5,5,6,6,6-h... CAS#:647-84-7 |
| Literature: Gorbunova; Zapevalov; Saloutin Russian Journal of Organic Chemistry, 1998 , vol. 34, # 3 p. 360 - 362 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1765-92-0| 1-Hexanol,4,4,5,5,6,6,6-heptafluoro-2-iodo |
| 4,4,5,5,6,6,6-heptafluoro-2-iodo-hexan-1-ol |
| 1,1,1,2,2,3,3-Heptafluoro-6-hydroxy-5-iodohexane |
| 2-Iod-4,4,5,5,6,6,6-heptafluor-hexan-1-ol |
| 4,4,5,5,6,6,6-Heptafluor-2-iod-hexanol |