4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene
4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene structure
|
Common Name | 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene | ||
|---|---|---|---|---|
| CAS Number | 647-71-2 | Molecular Weight | 282.94700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5Cl2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5Cl2F8 |
|---|---|
| Molecular Weight | 282.94700 |
| Exact Mass | 281.92500 |
| LogP | 4.43550 |
| InChIKey | VOWXVIRSQBSZCD-UHFFFAOYSA-N |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(Cl)C(F)(F)Cl |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3109-87-3
CAS#:378-22-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-Pentene,4,5-dichloro-1,1,2,3,3,4,5,5-octafluoro |
| 4,5-dichloro-octafluoro-pent-1-ene |
| 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoro-pent-1-ene |
| 4,5-Dichlor-octafluor-pent-1-en |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: InChIKey of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is VOWXVIRSQBSZCD-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: Molecular weight of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is 282.94700. |
| Q: What are the downstream products of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: Related downstream products(CAS) of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene: 3109-87-3;378-22-3. |
| Q: What is the Chinese name of 647-71-2? |
| A: Chinese name of 647-71-2 is 647-71-2. |
| Q: What is the CAS number of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: CAS number of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is 647-71-2. |
| Q: What English synonyms does 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene have? |
| A: English synonyms of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene: 1-Pentene,4,5-dichloro-1,1,2,3,3,4,5,5-octafluoro, 4,5-dichloro-octafluoro-pent-1-ene, 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoro-pent-1-ene, 4,5-Dichlor-octafluor-pent-1-en. |
| Q: What is the SMILES notation of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: SMILES notation of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is FC(F)=C(F)C(F)(F)C(F)(Cl)C(F)(F)Cl. |
| Q: What is the LogP of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: LogP of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is 4.43550. |
| Q: What is the English name of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: The English name of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene. |
| Q: What is the molecular formula of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene? |
| A: Molecular formula of 4,5-dichloro-1,1,2,3,3,4,5,5-octafluoropent-1-ene is C5Cl2F8. |