2,3,3,4,4,5,5,6,6-Nonafluoro-1-methyl-1-cyclohexene
Modify Date: 2025-08-24 19:08:12
2,3,3,4,4,5,5,6,6-Nonafluoro-1-methyl-1-cyclohexene structure
|
Common Name | 2,3,3,4,4,5,5,6,6-Nonafluoro-1-methyl-1-cyclohexene | ||
|---|---|---|---|---|
| CAS Number | 647-53-0 | Molecular Weight | 258.08400 | |
| Density | 1.54g/cm3 | Boiling Point | 80.2ºC at 760 mmHg | |
| Molecular Formula | C7H3F9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 8.9ºC | |
| Name | 1,3,3,4,4,5,5,6,6-nonafluoro-2-methylcyclohexene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 80.2ºC at 760 mmHg |
| Molecular Formula | C7H3F9 |
| Molecular Weight | 258.08400 |
| Flash Point | 8.9ºC |
| Exact Mass | 258.00900 |
| LogP | 3.78470 |
| Index of Refraction | 1.317 |
| InChIKey | YFJWYKLLZFEYFL-UHFFFAOYSA-N |
| SMILES | CC1=C(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|
|
~%
2,3,3,4,4,5,5,6... CAS#:647-53-0 |
| Literature: Sayers,D.R. et al. Journal of the Chemical Society, 1964 , p. 3035 - 3043 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:336-08-3| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-methylnonafluorocyclohexene |
| Monomethylnonafluorocyclohexene |
| Cyclohexene,1-methylnonafluoro |