4-Amino-3-phenyl-2-thioxo-2,3-dihydro-5-thiazolecarboxylic acid 2-phen ylhydrazide structure
|
Common Name | 4-Amino-3-phenyl-2-thioxo-2,3-dihydro-5-thiazolecarboxylic acid 2-phen ylhydrazide | ||
|---|---|---|---|---|
| CAS Number | 64686-94-8 | Molecular Weight | 342.43900 | |
| Density | 1.47g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14N4OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-N',3-diphenyl-2-sulfanylidene-1,3-thiazole-5-carbohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Molecular Formula | C16H14N4OS2 |
| Molecular Weight | 342.43900 |
| Exact Mass | 342.06100 |
| PSA | 135.90000 |
| LogP | 4.83640 |
| Index of Refraction | 1.783 |
| InChIKey | ADQMXLVAJQXFLM-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)NNc2ccccc2)sc(=S)n1-c1ccccc1 |
| HS Code | 2934100090 |
|---|
|
~%
4-Amino-3-pheny... CAS#:64686-94-8 |
| Literature: Devani; Shishoo; Pathak; Parikh; Radhakrishnan; Padhya Arzneimittel-Forschung/Drug Research, 1977 , vol. 27, # 9 p. 1652 - 1655 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-Thiazolecarboxylic acid,2,3-dihydro-4-amino-3-phenyl-2-thioxo-,2-phenylhydrazide |
| 2,3-Dihydro-4-amino-3-phenyl-2-thioxo-5-thiazolecarboxylic acid 2-phenylhydrazide |
| 4-Amino-3-phenyl-2-thioxo-2,3-dihydro-5-thiazolecarboxylic acid 2-phenylhydrazide |
| 4-amino-3-phenyl-2-thioxo-2,3-dihydro-thiazole-5-carboxylic acid N'-phenyl-hydrazide |