oleic acid, compound with 1H-benzotriazole structure
|
Common Name | oleic acid, compound with 1H-benzotriazole | ||
|---|---|---|---|---|
| CAS Number | 64653-97-0 | Molecular Weight | 401.58500 | |
| Density | N/A | Boiling Point | 360ºC at 760 mmHg | |
| Molecular Formula | C24H39N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | 2H-benzotriazole,(Z)-octadec-9-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 360ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H39N3O2 |
| Molecular Weight | 401.58500 |
| Flash Point | 270.1ºC |
| Exact Mass | 401.30400 |
| PSA | 78.87000 |
| LogP | 7.06640 |
| InChIKey | FNPOUUYXQRTDRX-KVVVOXFISA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.c1ccc2n[nH]nc2c1 |
| Oleic acid,benzotriazole salt |
| Oleic acid,compound with 1H-benzotriazole |
| EINECS 264-996-0 |
| EINECS 301-265-8 |